C23H27N3O5S — CID 55768127
3,4-dimethoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-prop-2-enylbenzamide (PubChem CID 55768127) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55768127 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3,4-dimethoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)Nc2ccc(S(=O)(=O)/N=C3/CCCN3C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O5S/c1-5-7-16-14-17(15-20(30-3)22(16)31-4)23(27)24-18-9-11-19(12-10-18)32(28,29)25-21-8-6-13-26(21)2/h5,9-12,14-15H,1,6-8,13H2,2-4H3,(H,24,27)/b25-21- |
| InChIKey | MVJQQJDVAOQDDD-DAFNUICNSA-N |
| XLogP | 3.50 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|