C25H32N2O6S — CID 27896838
N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 27896838) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 27896838 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)Nc2ccc(OCC)c(S(=O)(=O)N3CCCCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H32N2O6S/c1-5-10-18-15-19(16-22(31-3)24(18)32-4)25(28)26-20-11-12-21(33-6-2)23(17-20)34(29,30)27-13-8-7-9-14-27/h5,11-12,15-17H,1,6-10,13-14H2,2-4H3,(H,26,28) |
| InChIKey | OKBQGNCTLCHYAU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|