C20H22N2O6S — CID 9390241
N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 9390241) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 9390241 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H22N2O6S/c1-2-26-17-8-6-15(12-19(17)29(24,25)22-9-3-4-10-22)21-20(23)14-5-7-16-18(11-14)28-13-27-16/h5-8,11-12H,2-4,9-10,13H2,1H3,(H,21,23) |
| InChIKey | KFVDEVSIDFZGGP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |