C21H24N2O5S — CID 71904754
N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 71904754) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 71904754 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15-6-8-17(13-20(15)29(25,26)23-10-4-2-3-5-11-23)22-21(24)16-7-9-18-19(12-16)28-14-27-18/h6-9,12-13H,2-5,10-11,14H2,1H3,(H,22,24) |
| InChIKey | KCMHLZZOELZYDX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |