C20H23IN2O3S — CID 3963878
N-(3-iodo-4-methylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 3963878) has the molecular formula C20H23IN2O3S and a molecular weight of 498.39 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-iodo-4-methylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3963878 |
| Molecular Formula | C20H23IN2O3S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)cc1I |
| InChI | InChI=1S/C20H23IN2O3S/c1-14-7-9-17(13-18(14)21)22-20(24)16-8-6-15(2)19(12-16)27(25,26)23-10-4-3-5-11-23/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,22,24) |
| InChIKey | DBDZDVLJWCYDAU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|