C20H24N4O6S — CID 25445526
4-amino-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide (PubChem CID 25445526) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-amino-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide.
| Compound Name | 4-amino-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 25445526 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 4-amino-N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H24N4O6S/c1-2-30-18-9-7-15(13-19(18)31(28,29)23-10-4-3-5-11-23)22-20(25)14-6-8-16(21)17(12-14)24(26)27/h6-9,12-13H,2-5,10-11,21H2,1H3,(H,22,25) |
| InChIKey | QTKPWRSOBXFZQW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|