C19H23N3O8S2 — CID 39739377
N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide (PubChem CID 39739377) has the molecular formula C19H23N3O8S2 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 39739377 |
| Molecular Formula | C19H23N3O8S2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(O)c([N+](=O)[O-])c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H23N3O8S2/c1-2-30-18-9-6-14(12-19(18)32(28,29)21-10-4-3-5-11-21)20-31(26,27)15-7-8-17(23)16(13-15)22(24)25/h6-9,12-13,20,23H,2-5,10-11H2,1H3 |
| InChIKey | QWKYILNQYHIBBE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|