C18H21N3O8S2 — CID 4831846
4-hydroxy-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzenesulfonamide (PubChem CID 4831846) has the molecular formula C18H21N3O8S2 and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-hydroxy-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4831846 |
| Molecular Formula | C18H21N3O8S2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 4-hydroxy-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(O)c([N+](=O)[O-])c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H21N3O8S2/c1-29-17-8-5-13(11-18(17)31(27,28)20-9-3-2-4-10-20)19-30(25,26)14-6-7-16(22)15(12-14)21(23)24/h5-8,11-12,19,22H,2-4,9-10H2,1H3 |
| InChIKey | ZVFGASGCBDHZTF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|