C14H14N2O7S2 — CID 30180860
N-(4-ethylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide (PubChem CID 30180860) has the molecular formula C14H14N2O7S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-(4-ethylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-ethylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 30180860 |
| Molecular Formula | C14H14N2O7S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | N-(4-ethylsulfonylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C14H14N2O7S2/c1-2-24(20,21)11-5-3-10(4-6-11)15-25(22,23)12-7-8-14(17)13(9-12)16(18)19/h3-9,15,17H,2H2,1H3 |
| InChIKey | QWGQODUIFXRBPJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|