C10H10N4O5S2 — CID 103740820
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide (PubChem CID 103740820) has the molecular formula C10H10N4O5S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 103740820 |
| Molecular Formula | C10H10N4O5S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(O)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C10H10N4O5S2/c1-2-9-11-12-10(20-9)13-21(18,19)6-3-4-8(15)7(5-6)14(16)17/h3-5,15H,2H2,1H3,(H,12,13) |
| InChIKey | TUHPXAVJBJNTKY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|