C9H6BrN3O5S2 — CID 60785749
N-(5-bromo-1,3-thiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide (PubChem CID 60785749) has the molecular formula C9H6BrN3O5S2 and a molecular weight of 380.20 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60785749 |
| Molecular Formula | C9H6BrN3O5S2 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 378.89 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-4-hydroxy-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncc(Br)s2)ccc1O |
| InChI | InChI=1S/C9H6BrN3O5S2/c10-8-4-11-9(19-8)12-20(17,18)5-1-2-7(14)6(3-5)13(15)16/h1-4,14H,(H,11,12) |
| InChIKey | VGXGAGOASNWESS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|