C9H5BrClN3O4S2 — CID 106611531
3-bromo-4-chloro-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 106611531) has the molecular formula C9H5BrClN3O4S2 and a molecular weight of 398.65 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106611531 |
| Molecular Formula | C9H5BrClN3O4S2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 396.86 |
| IUPAC Name | 3-bromo-4-chloro-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cnc(NS(=O)(=O)c2ccc(Cl)c(Br)c2)s1 |
| InChI | InChI=1S/C9H5BrClN3O4S2/c10-6-3-5(1-2-7(6)11)20(17,18)13-9-12-4-8(19-9)14(15)16/h1-4H,(H,12,13) |
| InChIKey | MJRXPWGCFWMBLJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|