C8H6ClN5O6S3 — CID 10810971
5-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 10810971) has the molecular formula C8H6ClN5O6S3 and a molecular weight of 399.82 g/mol. Its IUPAC name is 5-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10810971 |
| Molecular Formula | C8H6ClN5O6S3 |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | 5-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C8H6ClN5O6S3/c9-5-2-1-4(3-6(5)14(15)16)23(19,20)13-7-11-12-8(21-7)22(10,17)18/h1-3H,(H,11,13)(H2,10,17,18) |
| InChIKey | TVXIRRUAMKXIHC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|