C7H7ClN4O4S2 — CID 65214693
[(4-chloro-3-nitrophenyl)sulfonylamino]thiourea (PubChem CID 65214693) has the molecular formula C7H7ClN4O4S2 and a molecular weight of 310.74 g/mol. Its IUPAC name is [(4-chloro-3-nitrophenyl)sulfonylamino]thiourea.
| Compound Name | [(4-chloro-3-nitrophenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 65214693 |
| Molecular Formula | C7H7ClN4O4S2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | [(4-chloro-3-nitrophenyl)sulfonylamino]thiourea |
| SMILES | NC(=S)NNS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7ClN4O4S2/c8-5-2-1-4(3-6(5)12(13)14)18(15,16)11-10-7(9)17/h1-3,11H,(H3,9,10,17) |
| InChIKey | AXHBOTHJSOUYOP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|