C12H7Cl4N3O4S — CID 42993401
4-chloro-3-nitro-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide (PubChem CID 42993401) has the molecular formula C12H7Cl4N3O4S and a molecular weight of 431.08 g/mol. Its IUPAC name is 4-chloro-3-nitro-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide.
| Compound Name | 4-chloro-3-nitro-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 42993401 |
| Molecular Formula | C12H7Cl4N3O4S |
| Molecular Weight | 431.08 g/mol |
| Exact Mass | 428.89 |
| IUPAC Name | 4-chloro-3-nitro-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C12H7Cl4N3O4S/c13-6-3-9(15)12(10(16)4-6)17-18-24(22,23)7-1-2-8(14)11(5-7)19(20)21/h1-5,17-18H |
| InChIKey | TUPJWGOXYJYOCW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.08 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|