C13H12ClN5O7S2 — CID 118710604
1-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(4-sulfamoylphenyl)urea (PubChem CID 118710604) has the molecular formula C13H12ClN5O7S2 and a molecular weight of 449.85 g/mol. Its IUPAC name is 1-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 118710604 |
| Molecular Formula | C13H12ClN5O7S2 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 1-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NNS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C13H12ClN5O7S2/c14-11-6-5-10(7-12(11)19(21)22)28(25,26)18-17-13(20)16-8-1-3-9(4-2-8)27(15,23)24/h1-7,18H,(H2,15,23,24)(H2,16,17,20) |
| InChIKey | UZDWRDBTUKXZLE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 190.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|