C14H11ClN4O6S — CID 108508659
N'-(2-chloro-5-nitrophenyl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508659) has the molecular formula C14H11ClN4O6S and a molecular weight of 398.78 g/mol. Its IUPAC name is N'-(2-chloro-5-nitrophenyl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-(2-chloro-5-nitrophenyl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508659 |
| Molecular Formula | C14H11ClN4O6S |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N'-(2-chloro-5-nitrophenyl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C14H11ClN4O6S/c15-11-6-3-9(19(22)23)7-12(11)18-14(21)13(20)17-8-1-4-10(5-2-8)26(16,24)25/h1-7H,(H,17,20)(H,18,21)(H2,16,24,25) |
| InChIKey | KWXPDLTUSPFVRQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|