C15H14N4O6S — CID 10022521
2-acetamido-4-nitro-N-(4-sulfamoylphenyl)benzamide (PubChem CID 10022521) has the molecular formula C15H14N4O6S and a molecular weight of 378.37 g/mol. Its IUPAC name is 2-acetamido-4-nitro-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-acetamido-4-nitro-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 10022521 |
| Molecular Formula | C15H14N4O6S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-acetamido-4-nitro-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])ccc1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14N4O6S/c1-9(20)17-14-8-11(19(22)23)4-7-13(14)15(21)18-10-2-5-12(6-3-10)26(16,24)25/h2-8H,1H3,(H,17,20)(H,18,21)(H2,16,24,25) |
| InChIKey | AHAYMFYFBABDNL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|