C14H12N4O7S — CID 19174927
4-methyl-3,5-dinitro-N-(4-sulfamoylphenyl)benzamide (PubChem CID 19174927) has the molecular formula C14H12N4O7S and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-methyl-3,5-dinitro-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-methyl-3,5-dinitro-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 19174927 |
| Molecular Formula | C14H12N4O7S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 4-methyl-3,5-dinitro-N-(4-sulfamoylphenyl)benzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N4O7S/c1-8-12(17(20)21)6-9(7-13(8)18(22)23)14(19)16-10-2-4-11(5-3-10)26(15,24)25/h2-7H,1H3,(H,16,19)(H2,15,24,25) |
| InChIKey | CNUMXSBOHLAUJO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|