C14H11N2NaO6S — CID 3019588
sodium 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonate (PubChem CID 3019588) has the molecular formula C14H11N2NaO6S and a molecular weight of 358.31 g/mol. Its IUPAC name is sodium 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonate.
| Compound Name | sodium 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 3019588 |
| Molecular Formula | C14H11N2NaO6S |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | sodium 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)[O-])cc2)cc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C14H12N2O6S.Na/c1-9-2-3-10(8-13(9)16(18)19)14(17)15-11-4-6-12(7-5-11)23(20,21)22;/h2-8H,1H3,(H,15,17)(H,20,21,22);/q;+1/p-1 |
| InChIKey | YLDIMJOASVRWAO-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|