C14H12N2O6S — CID 3019589
4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonic acid (PubChem CID 3019589) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonic acid.
| Compound Name | 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 3019589 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[(4-methyl-3-nitrobenzoyl)amino]benzenesulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N2O6S/c1-9-2-3-10(8-13(9)16(18)19)14(17)15-11-4-6-12(7-5-11)23(20,21)22/h2-8H,1H3,(H,15,17)(H,20,21,22) |
| InChIKey | RLVVHEISMLHVND-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|