C25H19N3O7S — CID 141031696
5-[[3-[(4-methyl-3-nitrobenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid (PubChem CID 141031696) has the molecular formula C25H19N3O7S and a molecular weight of 505.51 g/mol. Its IUPAC name is 5-[[3-[(4-methyl-3-nitrobenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid.
| Compound Name | 5-[[3-[(4-methyl-3-nitrobenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 141031696 |
| Molecular Formula | C25H19N3O7S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 5-[[3-[(4-methyl-3-nitrobenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(=O)Nc3cccc4cc(S(=O)(=O)O)ccc34)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H19N3O7S/c1-15-8-9-18(14-23(15)28(31)32)24(29)26-19-6-2-5-17(12-19)25(30)27-22-7-3-4-16-13-20(36(33,34)35)10-11-21(16)22/h2-14H,1H3,(H,26,29)(H,27,30)(H,33,34,35) |
| InChIKey | OSRLXPSXUWCOPT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|