C25H20N2O5S — CID 141031698
5-[[3-[(4-methylbenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid (PubChem CID 141031698) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is 5-[[3-[(4-methylbenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid.
| Compound Name | 5-[[3-[(4-methylbenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 141031698 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 5-[[3-[(4-methylbenzoyl)amino]benzoyl]amino]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(=O)Nc3cccc4cc(S(=O)(=O)O)ccc34)c2)cc1 |
| InChI | InChI=1S/C25H20N2O5S/c1-16-8-10-17(11-9-16)24(28)26-20-6-2-5-19(14-20)25(29)27-23-7-3-4-18-15-21(33(30,31)32)12-13-22(18)23/h2-15H,1H3,(H,26,28)(H,27,29)(H,30,31,32) |
| InChIKey | QBJTVVQPZQXVND-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|