C35H26N4O11S2 — CID 20564527
5-hydroxy-6-[[3-[[3-[(1-hydroxy-6-sulfonaphthalen-2-yl)carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-2-sulfonic acid (PubChem CID 20564527) has the molecular formula C35H26N4O11S2 and a molecular weight of 742.74 g/mol. Its IUPAC name is 5-hydroxy-6-[[3-[[3-[(1-hydroxy-6-sulfonaphthalen-2-yl)carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-2-sulfonic acid.
| Compound Name | 5-hydroxy-6-[[3-[[3-[(1-hydroxy-6-sulfonaphthalen-2-yl)carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20564527 |
| Molecular Formula | C35H26N4O11S2 |
| Molecular Weight | 742.74 g/mol |
| Exact Mass | 742.10 |
| IUPAC Name | 5-hydroxy-6-[[3-[[3-[(1-hydroxy-6-sulfonaphthalen-2-yl)carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccc3cc(S(=O)(=O)O)ccc3c2O)c1)Nc1cccc(C(=O)Nc2ccc3cc(S(=O)(=O)O)ccc3c2O)c1 |
| InChI | InChI=1S/C35H26N4O11S2/c40-31-27-11-9-25(51(45,46)47)17-19(27)7-13-29(31)38-33(42)21-3-1-5-23(15-21)36-35(44)37-24-6-2-4-22(16-24)34(43)39-30-14-8-20-18-26(52(48,49)50)10-12-28(20)32(30)41/h1-18,40-41H,(H,38,42)(H,39,43)(H2,36,37,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | YZLRXZPNFXKELD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 248.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|