C35H28N4O15S4 — CID 59085170
6-[[3-[[3-[[5-sulfo-7-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-1,3-disulfonic acid (PubChem CID 59085170) has the molecular formula C35H28N4O15S4 and a molecular weight of 872.89 g/mol. Its IUPAC name is 6-[[3-[[3-[[5-sulfo-7-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 6-[[3-[[3-[[5-sulfo-7-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 59085170 |
| Molecular Formula | C35H28N4O15S4 |
| Molecular Weight | 872.89 g/mol |
| Exact Mass | 872.04 |
| IUPAC Name | 6-[[3-[[3-[[5-sulfo-7-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccc3c(S(=O)(=O)O)cc(S(O)(O)O)cc3c2)c1)Nc1cccc(C(=O)Nc2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c2)c1 |
| InChI | InChI=1S/C35H28N4O15S4/c40-33(36-25-7-9-29-21(13-25)15-27(55(43,44)45)17-31(29)57(49,50)51)19-3-1-5-23(11-19)38-35(42)39-24-6-2-4-20(12-24)34(41)37-26-8-10-30-22(14-26)16-28(56(46,47)48)18-32(30)58(52,53)54/h1-18,43-45H,(H,36,40)(H,37,41)(H2,38,39,42)(H,46,47,48)(H,49,50,51)(H,52,53,54) |
| InChIKey | XFZQYLALJLLAGF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 323.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.89 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|