C32H22N2O14S4 — CID 21053607
6-[[7-[[5-sulfo-7-(trioxidanylsulfanyl)naphthalen-2-yl]carbamoyl]naphthalene-2-carbonyl]amino]naphthalene-1,3-disulfonic acid (PubChem CID 21053607) has the molecular formula C32H22N2O14S4 and a molecular weight of 786.80 g/mol. Its IUPAC name is 6-[[7-[[5-sulfo-7-(trioxidanylsulfanyl)naphthalen-2-yl]carbamoyl]naphthalene-2-carbonyl]amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 6-[[7-[[5-sulfo-7-(trioxidanylsulfanyl)naphthalen-2-yl]carbamoyl]naphthalene-2-carbonyl]amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 21053607 |
| Molecular Formula | C32H22N2O14S4 |
| Molecular Weight | 786.80 g/mol |
| Exact Mass | 786.00 |
| IUPAC Name | 6-[[7-[[5-sulfo-7-(trioxidanylsulfanyl)naphthalen-2-yl]carbamoyl]naphthalene-2-carbonyl]amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=C(Nc1ccc2c(S(=O)(=O)O)cc(SOOO)cc2c1)c1ccc2ccc(C(=O)Nc3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4c3)cc2c1 |
| InChI | InChI=1S/C32H22N2O14S4/c35-31(33-23-5-7-27-21(11-23)13-25(49-48-47-37)15-29(27)51(41,42)43)18-3-1-17-2-4-19(10-20(17)9-18)32(36)34-24-6-8-28-22(12-24)14-26(50(38,39)40)16-30(28)52(44,45)46/h1-16,37H,(H,33,35)(H,34,36)(H,38,39,40)(H,41,42,43)(H,44,45,46) |
| InChIKey | MYHAQESAUBENDT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 260.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.80 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|