C24H19N5O9S4 — CID 20654817
6-[[6-[(7-methyl-5-sulfonaphthalen-2-yl)amino]-4-sulfanylidene-1H-1,3,5-triazin-2-yl]amino]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid (PubChem CID 20654817) has the molecular formula C24H19N5O9S4 and a molecular weight of 649.71 g/mol. Its IUPAC name is 6-[[6-[(7-methyl-5-sulfonaphthalen-2-yl)amino]-4-sulfanylidene-1H-1,3,5-triazin-2-yl]amino]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid.
| Compound Name | 6-[[6-[(7-methyl-5-sulfonaphthalen-2-yl)amino]-4-sulfanylidene-1H-1,3,5-triazin-2-yl]amino]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 20654817 |
| Molecular Formula | C24H19N5O9S4 |
| Molecular Weight | 649.71 g/mol |
| Exact Mass | 649.01 |
| IUPAC Name | 6-[[6-[(7-methyl-5-sulfonaphthalen-2-yl)amino]-4-sulfanylidene-1H-1,3,5-triazin-2-yl]amino]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2ccc(Nc3nc(=S)nc(Nc4ccc5c(S(=O)(=O)O)cc(SOOO)cc5c4)[nH]3)cc2c1 |
| InChI | InChI=1S/C24H19N5O9S4/c1-12-6-13-8-15(2-4-18(13)20(7-12)41(31,32)33)25-22-27-23(29-24(39)28-22)26-16-3-5-19-14(9-16)10-17(40-38-37-30)11-21(19)42(34,35)36/h2-11,30H,1H3,(H,31,32,33)(H,34,35,36)(H3,25,26,27,28,29,39) |
| InChIKey | OTXMEHUJWRYKJE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|