C11H12N2O3S — CID 167553927
7-hydrazinyl-3-methylnaphthalene-1-sulfonic acid (PubChem CID 167553927) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 7-hydrazinyl-3-methylnaphthalene-1-sulfonic acid.
| Compound Name | 7-hydrazinyl-3-methylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 167553927 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 7-hydrazinyl-3-methylnaphthalene-1-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2cc(NN)ccc2c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-7-4-8-2-3-9(13-12)6-10(8)11(5-7)17(14,15)16/h2-6,13H,12H2,1H3,(H,14,15,16) |
| InChIKey | XMDGMKFSDWFQGM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|