C23H20O6S2 — CID 102104390
3-methyl-7-[(6-methyl-8-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid (PubChem CID 102104390) has the molecular formula C23H20O6S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-methyl-7-[(6-methyl-8-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid.
| Compound Name | 3-methyl-7-[(6-methyl-8-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 102104390 |
| Molecular Formula | C23H20O6S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 3-methyl-7-[(6-methyl-8-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2cc(Cc3ccc4cc(C)cc(S(=O)(=O)O)c4c3)ccc2c1 |
| InChI | InChI=1S/C23H20O6S2/c1-14-7-18-5-3-16(12-20(18)22(9-14)30(24,25)26)11-17-4-6-19-8-15(2)10-23(21(19)13-17)31(27,28)29/h3-10,12-13H,11H2,1-2H3,(H,24,25,26)(H,27,28,29) |
| InChIKey | FOANKUBSXKWJAJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|