C12H13NaO3S — CID 173399214
sodium;3,7-dimethylnaphthalene-1-sulfonic acid;hydride (PubChem CID 173399214) has the molecular formula C12H13NaO3S and a molecular weight of 260.29 g/mol. Its IUPAC name is sodium;3,7-dimethylnaphthalene-1-sulfonic acid;hydride.
| Compound Name | sodium;3,7-dimethylnaphthalene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173399214 |
| Molecular Formula | C12H13NaO3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | sodium;3,7-dimethylnaphthalene-1-sulfonic acid;hydride |
| SMILES | Cc1cc(S(=O)(=O)O)c2cc(C)ccc2c1.[H-].[Na+] |
| InChI | InChI=1S/C12H12O3S.Na.H/c1-8-3-4-10-5-9(2)7-12(11(10)6-8)16(13,14)15;;/h3-7H,1-2H3,(H,13,14,15);;/q;+1;-1 |
| InChIKey | HZPSHROGKBLUQK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|