C11H8Na2O6S2 — CID 20739188
disodium;7-methylnaphthalene-1,3-disulfonate (PubChem CID 20739188) has the molecular formula C11H8Na2O6S2 and a molecular weight of 346.29 g/mol. Its IUPAC name is disodium;7-methylnaphthalene-1,3-disulfonate.
| Compound Name | disodium;7-methylnaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 20739188 |
| Molecular Formula | C11H8Na2O6S2 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | disodium;7-methylnaphthalene-1,3-disulfonate |
| SMILES | Cc1ccc2cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c2c1.[Na+].[Na+] |
| InChI | InChI=1S/C11H10O6S2.2Na/c1-7-2-3-8-5-9(18(12,13)14)6-11(10(8)4-7)19(15,16)17;;/h2-6H,1H3,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | HVAZYFPLNGTDCD-UHFFFAOYSA-L |
| XLogP | -5.04 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|