C10H5INa2O6S2 — CID 25229433
disodium;6-iodonaphthalene-1,3-disulfonate (PubChem CID 25229433) has the molecular formula C10H5INa2O6S2 and a molecular weight of 458.16 g/mol. Its IUPAC name is disodium;6-iodonaphthalene-1,3-disulfonate.
| Compound Name | disodium;6-iodonaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 25229433 |
| Molecular Formula | C10H5INa2O6S2 |
| Molecular Weight | 458.16 g/mol |
| Exact Mass | 457.84 |
| IUPAC Name | disodium;6-iodonaphthalene-1,3-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2ccc(I)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H7IO6S2.2Na/c11-7-1-2-9-6(3-7)4-8(18(12,13)14)5-10(9)19(15,16)17;;/h1-5H,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | VNKOVBSXQZWBNV-UHFFFAOYSA-L |
| XLogP | -4.74 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.16 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|