C14H7I2O3S- — CID 177131226
6,10-diiodophenanthrene-3-sulfonate (PubChem CID 177131226) has the molecular formula C14H7I2O3S- and a molecular weight of 509.08 g/mol. Its IUPAC name is 6,10-diiodophenanthrene-3-sulfonate.
| Compound Name | 6,10-diiodophenanthrene-3-sulfonate |
|---|---|
| PubChem CID | 177131226 |
| Molecular Formula | C14H7I2O3S- |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.82 |
| IUPAC Name | 6,10-diiodophenanthrene-3-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(I)cc3ccc(I)cc3c2c1 |
| InChI | InChI=1S/C14H8I2O3S/c15-9-2-1-8-5-14(16)11-4-3-10(20(17,18)19)7-13(11)12(8)6-9/h1-7H,(H,17,18,19)/p-1 |
| InChIKey | AIQPGVZXNJADLI-UHFFFAOYSA-M |
| XLogP | 4.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|