C10H5I2O3S- — CID 177131444
6,7-diiodonaphthalene-2-sulfonate (PubChem CID 177131444) has the molecular formula C10H5I2O3S- and a molecular weight of 459.02 g/mol. Its IUPAC name is 6,7-diiodonaphthalene-2-sulfonate.
| Compound Name | 6,7-diiodonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 177131444 |
| Molecular Formula | C10H5I2O3S- |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.81 |
| IUPAC Name | 6,7-diiodonaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2cc(I)c(I)cc2c1 |
| InChI | InChI=1S/C10H6I2O3S/c11-9-4-6-1-2-8(16(13,14)15)3-7(6)5-10(9)12/h1-5H,(H,13,14,15)/p-1 |
| InChIKey | HHNUWUCRWZYGJB-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|