C12H11NaO3S — CID 101315129
sodium 6-ethylnaphthalene-2-sulfonate (PubChem CID 101315129) has the molecular formula C12H11NaO3S and a molecular weight of 258.27 g/mol. Its IUPAC name is sodium 6-ethylnaphthalene-2-sulfonate.
| Compound Name | sodium 6-ethylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 101315129 |
| Molecular Formula | C12H11NaO3S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | sodium 6-ethylnaphthalene-2-sulfonate |
| SMILES | CCc1ccc2cc(S(=O)(=O)[O-])ccc2c1.[Na+] |
| InChI | InChI=1S/C12H12O3S.Na/c1-2-9-3-4-11-8-12(16(13,14)15)6-5-10(11)7-9;/h3-8H,2H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | TXTPHAPQDQUYOT-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|