C12H18N6O6S2 — CID 142698795
bis(diaminomethylideneazanium);naphthalene-2,6-disulfonate (PubChem CID 142698795) has the molecular formula C12H18N6O6S2 and a molecular weight of 406.45 g/mol. Its IUPAC name is bis(diaminomethylideneazanium);naphthalene-2,6-disulfonate.
| Compound Name | bis(diaminomethylideneazanium);naphthalene-2,6-disulfonate |
|---|---|
| PubChem CID | 142698795 |
| Molecular Formula | C12H18N6O6S2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | bis(diaminomethylideneazanium);naphthalene-2,6-disulfonate |
| SMILES | NC(N)=[NH2+].NC(N)=[NH2+].O=S(=O)([O-])c1ccc2cc(S(=O)(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C10H8O6S2.2CH5N3/c11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9;2*2-1(3)4/h1-6H,(H,11,12,13)(H,14,15,16);2*(H5,2,3,4) |
| InChIKey | YEUWSYLEJUKTGC-UHFFFAOYSA-N |
| XLogP | -5.31 |
| TPSA | 269.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|