C12H11O5S- — CID 18415261
6,7-dimethoxynaphthalene-2-sulfonate (PubChem CID 18415261) has the molecular formula C12H11O5S- and a molecular weight of 267.28 g/mol. Its IUPAC name is 6,7-dimethoxynaphthalene-2-sulfonate.
| Compound Name | 6,7-dimethoxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 18415261 |
| Molecular Formula | C12H11O5S- |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6,7-dimethoxynaphthalene-2-sulfonate |
| SMILES | COc1cc2ccc(S(=O)(=O)[O-])cc2cc1OC |
| InChI | InChI=1S/C12H12O5S/c1-16-11-6-8-3-4-10(18(13,14)15)5-9(8)7-12(11)17-2/h3-7H,1-2H3,(H,13,14,15)/p-1 |
| InChIKey | IMSZMAMIAUKQMV-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|