C17H13NaO6S2 — CID 23712166
sodium 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate (PubChem CID 23712166) has the molecular formula C17H13NaO6S2 and a molecular weight of 400.41 g/mol. Its IUPAC name is sodium 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate.
| Compound Name | sodium 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 23712166 |
| Molecular Formula | C17H13NaO6S2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | sodium 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3cc(S(=O)(=O)[O-])ccc3c2)cc1.[Na+] |
| InChI | InChI=1S/C17H14O6S2.Na/c1-12-2-7-16(8-3-12)25(21,22)23-15-6-4-14-11-17(24(18,19)20)9-5-13(14)10-15;/h2-11H,1H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | QXSVVZZBBYDLQB-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|