C25H21IO6S2 — CID 18432134
diphenyliodanium;4-(4-methylphenyl)sulfonyloxybenzenesulfonate (PubChem CID 18432134) has the molecular formula C25H21IO6S2 and a molecular weight of 608.48 g/mol. Its IUPAC name is diphenyliodanium;4-(4-methylphenyl)sulfonyloxybenzenesulfonate.
| Compound Name | diphenyliodanium;4-(4-methylphenyl)sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 18432134 |
| Molecular Formula | C25H21IO6S2 |
| Molecular Weight | 608.48 g/mol |
| Exact Mass | 607.98 |
| IUPAC Name | diphenyliodanium;4-(4-methylphenyl)sulfonyloxybenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)[O-])cc2)cc1.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O6S2.C12H10I/c1-10-2-6-13(7-3-10)21(17,18)19-11-4-8-12(9-5-11)20(14,15)16;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h2-9H,1H3,(H,14,15,16);1-10H/q;+1/p-1 |
| InChIKey | YBPTZBCWGJRZPT-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|