C12H11MgNO7S2 — CID 167343884
magnesium;pyridin-4-yl 4-methylbenzenesulfonate;sulfate (PubChem CID 167343884) has the molecular formula C12H11MgNO7S2 and a molecular weight of 369.66 g/mol. Its IUPAC name is magnesium;pyridin-4-yl 4-methylbenzenesulfonate;sulfate.
| Compound Name | magnesium;pyridin-4-yl 4-methylbenzenesulfonate;sulfate |
|---|---|
| PubChem CID | 167343884 |
| Molecular Formula | C12H11MgNO7S2 |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | magnesium;pyridin-4-yl 4-methylbenzenesulfonate;sulfate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccncc2)cc1.O=S(=O)([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C12H11NO3S.Mg.H2O4S/c1-10-2-4-12(5-3-10)17(14,15)16-11-6-8-13-9-7-11;;1-5(2,3)4/h2-9H,1H3;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | IXTPXZFHTNMDFP-UHFFFAOYSA-L |
| XLogP | 0.44 |
| TPSA | 136.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|