C14H14O5S2 — CID 20811037
(4-methylsulfonylphenyl) 4-methylbenzenesulfonate (PubChem CID 20811037) has the molecular formula C14H14O5S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (4-methylsulfonylphenyl) 4-methylbenzenesulfonate.
| Compound Name | (4-methylsulfonylphenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 20811037 |
| Molecular Formula | C14H14O5S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | (4-methylsulfonylphenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H14O5S2/c1-11-3-7-14(8-4-11)21(17,18)19-12-5-9-13(10-6-12)20(2,15)16/h3-10H,1-2H3 |
| InChIKey | MNBQZKAXJLYFKR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|