C13H10F2O5S2 — CID 31534432
(3,4-difluorophenyl) 4-methylsulfonylbenzenesulfonate (PubChem CID 31534432) has the molecular formula C13H10F2O5S2 and a molecular weight of 348.35 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-methylsulfonylbenzenesulfonate.
| Compound Name | (3,4-difluorophenyl) 4-methylsulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 31534432 |
| Molecular Formula | C13H10F2O5S2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (3,4-difluorophenyl) 4-methylsulfonylbenzenesulfonate |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)Oc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C13H10F2O5S2/c1-21(16,17)10-3-5-11(6-4-10)22(18,19)20-9-2-7-12(14)13(15)8-9/h2-8H,1H3 |
| InChIKey | LLPZHNGGCHDEDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|