C13H7F2NO3S — CID 51169234
(3-cyanophenyl) 3,4-difluorobenzenesulfonate (PubChem CID 51169234) has the molecular formula C13H7F2NO3S and a molecular weight of 295.27 g/mol. Its IUPAC name is (3-cyanophenyl) 3,4-difluorobenzenesulfonate.
| Compound Name | (3-cyanophenyl) 3,4-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 51169234 |
| Molecular Formula | C13H7F2NO3S |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | (3-cyanophenyl) 3,4-difluorobenzenesulfonate |
| SMILES | N#Cc1cccc(OS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H7F2NO3S/c14-12-5-4-11(7-13(12)15)20(17,18)19-10-3-1-2-9(6-10)8-16/h1-7H |
| InChIKey | QAWKHUVYIPDGES-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|