About (3-cyanophenyl) 2-cyanobenzenesulfonate
(3-cyanophenyl) 2-cyanobenzenesulfonate (PubChem CID 25496663) has the molecular formula C14H8N2O3S
and a molecular weight of 284.30 g/mol. Its IUPAC name is (3-cyanophenyl) 2-cyanobenzenesulfonate.
Molecular Properties
| Compound Name | (3-cyanophenyl) 2-cyanobenzenesulfonate |
| PubChem CID | 25496663 |
| Molecular Formula | C14H8N2O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (3-cyanophenyl) 2-cyanobenzenesulfonate |
| SMILES | N#Cc1cccc(OS(=O)(=O)c2ccccc2C#N)c1 |
| InChI | InChI=1S/C14H8N2O3S/c15-9-11-4-3-6-13(8-11)19-20(17,18)14-7-2-1-5-12(14)10-16/h1-8H |
| InChIKey | GZDAPMNTKARISU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-cyanophenyl) 2-cyanobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyanophenyl) 2-cyanobenzenesulfonate?
The IUPAC name of (3-cyanophenyl) 2-cyanobenzenesulfonate (CID 25496663) is (3-cyanophenyl) 2-cyanobenzenesulfonate.
What is the SMILES notation for (3-cyanophenyl) 2-cyanobenzenesulfonate?
The canonical SMILES for (3-cyanophenyl) 2-cyanobenzenesulfonate is N#Cc1cccc(OS(=O)(=O)c2ccccc2C#N)c1.
What is the InChIKey of (3-cyanophenyl) 2-cyanobenzenesulfonate?
The InChIKey is GZDAPMNTKARISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O3S/c15-9-11-4-3-6-13(8-11)19-20(17,18)14-7-2-1-5-12(14)10-16/h1-8H.
What are the key properties of (3-cyanophenyl) 2-cyanobenzenesulfonate?
(3-cyanophenyl) 2-cyanobenzenesulfonate has a molecular weight of 284.30 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyanophenyl) 2-cyanobenzenesulfonate is sourced from PubChem (CID 25496663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).