C13H7ClF4O4S — CID 55681662
(3,4-difluorophenyl) 3-chloro-4-(difluoromethoxy)benzenesulfonate (PubChem CID 55681662) has the molecular formula C13H7ClF4O4S and a molecular weight of 370.71 g/mol. Its IUPAC name is (3,4-difluorophenyl) 3-chloro-4-(difluoromethoxy)benzenesulfonate.
| Compound Name | (3,4-difluorophenyl) 3-chloro-4-(difluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 55681662 |
| Molecular Formula | C13H7ClF4O4S |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | (3,4-difluorophenyl) 3-chloro-4-(difluoromethoxy)benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)c(F)c1)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H7ClF4O4S/c14-9-6-8(2-4-12(9)21-13(17)18)23(19,20)22-7-1-3-10(15)11(16)5-7/h1-6,13H |
| InChIKey | GVTIPEGFIDUMOQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|