C13H6F6O3S — CID 52746589
(3,4-difluorophenyl) 4-fluoro-3-(trifluoromethyl)benzenesulfonate (PubChem CID 52746589) has the molecular formula C13H6F6O3S and a molecular weight of 356.24 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-fluoro-3-(trifluoromethyl)benzenesulfonate.
| Compound Name | (3,4-difluorophenyl) 4-fluoro-3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 52746589 |
| Molecular Formula | C13H6F6O3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | (3,4-difluorophenyl) 4-fluoro-3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)c(F)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6F6O3S/c14-10-4-2-8(6-9(10)13(17,18)19)23(20,21)22-7-1-3-11(15)12(16)5-7/h1-6H |
| InChIKey | VLIAOQPJEISPIO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|