C16H14F4O4S — CID 52746580
[4-(2-methoxyethyl)phenyl] 4-fluoro-3-(trifluoromethyl)benzenesulfonate (PubChem CID 52746580) has the molecular formula C16H14F4O4S and a molecular weight of 378.34 g/mol. Its IUPAC name is [4-(2-methoxyethyl)phenyl] 4-fluoro-3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-(2-methoxyethyl)phenyl] 4-fluoro-3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 52746580 |
| Molecular Formula | C16H14F4O4S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [4-(2-methoxyethyl)phenyl] 4-fluoro-3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCc1ccc(OS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H14F4O4S/c1-23-9-8-11-2-4-12(5-3-11)24-25(21,22)13-6-7-15(17)14(10-13)16(18,19)20/h2-7,10H,8-9H2,1H3 |
| InChIKey | ZFTSDSZBBHHFNP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|