C18H20N2O5S — CID 49453856
[4-(2-methoxyethyl)phenyl] 1,3-dimethyl-2-oxobenzimidazole-5-sulfonate (PubChem CID 49453856) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is [4-(2-methoxyethyl)phenyl] 1,3-dimethyl-2-oxobenzimidazole-5-sulfonate.
| Compound Name | [4-(2-methoxyethyl)phenyl] 1,3-dimethyl-2-oxobenzimidazole-5-sulfonate |
|---|---|
| PubChem CID | 49453856 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [4-(2-methoxyethyl)phenyl] 1,3-dimethyl-2-oxobenzimidazole-5-sulfonate |
| SMILES | COCCc1ccc(OS(=O)(=O)c2ccc3c(c2)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H20N2O5S/c1-19-16-9-8-15(12-17(16)20(2)18(19)21)26(22,23)25-14-6-4-13(5-7-14)10-11-24-3/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | SQCBSEOSRZCUDE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|