C18H18N3O6S- — CID 7335403
4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]ethoxy]benzoate (PubChem CID 7335403) has the molecular formula C18H18N3O6S- and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]ethoxy]benzoate.
| Compound Name | 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]ethoxy]benzoate |
|---|---|
| PubChem CID | 7335403 |
| Molecular Formula | C18H18N3O6S- |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]ethoxy]benzoate |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)NCCOc3ccc(C(=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C18H19N3O6S/c1-20-15-8-7-14(11-16(15)21(2)18(20)24)28(25,26)19-9-10-27-13-5-3-12(4-6-13)17(22)23/h3-8,11,19H,9-10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | HVDFXQMLWGJGOW-UHFFFAOYSA-M |
| XLogP | -0.40 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|