C13H19N3O3S — CID 49453627
N-butyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide (PubChem CID 49453627) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-butyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide.
| Compound Name | N-butyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 49453627 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-butyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H19N3O3S/c1-4-5-8-14-20(18,19)10-6-7-11-12(9-10)16(3)13(17)15(11)2/h6-7,9,14H,4-5,8H2,1-3H3 |
| InChIKey | DARNKNBDHCMWHC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|